cas: 688363-48-6 — see every product listed under this CAS number, including other names
8-BROMO-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 97% (CAS 688363-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305103-100MG |
| cas | 688363-48-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 2.5g | 1216.26 Pln | |
| Fluorochem | 5g | 1736.91 Pln | |
| Fluorochem | 10g | 3038.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-4H-1,4-benzoxazin-3-one (CAS 688363-48-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 8-bromo-4H-1,4-benzoxazin-3-one. InChIKey: FVGSWEPMUVKUDX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 8-bromo-4H-1,4-benzoxazin-3-one |
| InChIKey | FVGSWEPMUVKUDX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC=C2)Br |
Computed by PubChem (NCBI)