8-Bromo-3-iodoquinoline, 98%
cas: 917251-85-5 — see every product listed under this CAS number, including other names
8-Bromo-3-iodoquinoline, 98% (CAS 917251-85-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321425-100MG |
| cas | 917251-85-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 500mg | 544.62 Pln | |
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 1913.93 Pln | |
| Fluorochem | 10g | 3137.45 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
8-bromo-3-iodoquinoline (CAS 917251-85-5) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 8-bromo-3-iodoquinoline. InChIKey: JPJKDNAXYHDTSK-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 8-bromo-3-iodoquinoline |
| InChIKey | JPJKDNAXYHDTSK-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)Br)I |
Computed by PubChem (NCBI)