CAS 1354223-46-3 appears in our catalog under these names: 3-Bromo-7-iodoquinoline, 95%, 3-Bromo-7-iodoquinoline 95%, 3-Bromo-7-iodoquinoline, 97%, 3-Bromo-7-iodoquinoline, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g, 500mg, 10g, 25g.
3-bromo-7-iodoquinoline (CAS 1354223-46-3) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 3-bromo-7-iodoquinoline. InChIKey: BUYRRYFIHUENHV-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 3-bromo-7-iodoquinoline |
| InChIKey | BUYRRYFIHUENHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)Br)I |
Computed by PubChem (NCBI)