CAS 1026805-93-5 is the registry number for 2-Bromo-6-iodoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6-iodoquinoline (CAS 1026805-93-5) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 2-bromo-6-iodoquinoline. InChIKey: WIFJJNFFUPTDGU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 2-bromo-6-iodoquinoline |
| InChIKey | WIFJJNFFUPTDGU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)Br)C=C1I |
Computed by PubChem (NCBI)