CAS 1802820-08-1 appears in our catalog under these names: 8-Bromo-4-iodoisoquinoline, 98%, 1-(tetrahydro-2h-pyran-2-yl)-1h-pyrazole-4-carboxylic acid, >95%, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
8-bromo-4-iodoisoquinoline (CAS 1802820-08-1) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 8-bromo-4-iodoisoquinoline. InChIKey: NTKQWIVEEFNVLZ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 8-bromo-4-iodoisoquinoline |
| InChIKey | NTKQWIVEEFNVLZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NC=C2C(=C1)Br)I |
Computed by PubChem (NCBI)