CAS 1078160-90-3 appears in our catalog under these names: 6-Bromo-8-iodoquinoline, 98%, 6-Bromo-8-iodoquinoline, 95+%, 6-BROMO-8-IODOQUINOLINE, 6-Bromo-8-iodoquinoline 95%, 6-Bromo-8-iodoquinoline, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 2,5g, 100mg, 250mg.
6-bromo-8-iodoquinoline (CAS 1078160-90-3) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 6-bromo-8-iodoquinoline. InChIKey: CWBCAHFYCUZWTD-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 6-bromo-8-iodoquinoline |
| InChIKey | CWBCAHFYCUZWTD-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)I)Br |
Computed by PubChem (NCBI)