CAS 1416440-61-3 appears in our catalog under these names: 7-Bromo-3-iodoquinoline, 7-Bromo-3-iodoquinoline, 95%, 7-Bromo-3-iodoquinoline, 95%, 95%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 10g, 5g, 100mg.
7-bromo-3-iodoquinoline (CAS 1416440-61-3) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 7-bromo-3-iodoquinoline. InChIKey: SJYDYCSOXGKFPG-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 7-bromo-3-iodoquinoline |
| InChIKey | SJYDYCSOXGKFPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)I)Br |
Computed by PubChem (NCBI)