CAS 898559-23-4 appears in our catalog under these names: 3-Bromo-2-iodoquinoline, 95%, 3-Bromo-2-iodoquinoline, 95+%, 3-Bromo-2-iodoquinoline, 3-Bromo-2-iodoquinoline, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 2,5g.
3-bromo-2-iodoquinoline (CAS 898559-23-4) is a chemical compound with the molecular formula C9H5BrIN and a molecular weight of 333.95 g/mol. IUPAC name: 3-bromo-2-iodoquinoline. InChIKey: JOMFAVRBFOBWQA-UHFFFAOYSA-N.
| Molecular formula | C9H5BrIN |
|---|---|
| Molecular weight | 333.95 g/mol |
| IUPAC name | 3-bromo-2-iodoquinoline |
| InChIKey | JOMFAVRBFOBWQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)I)Br |
Computed by PubChem (NCBI)