cas: 2442-31-1 — see every product listed under this CAS number, including other names
8-Hydroxycoumarin, 98% (CAS 2442-31-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F788079-50MG |
| cas | 2442-31-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 289.50 Pln | |
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 2653.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
8-hydroxychromen-2-one (CAS 2442-31-1) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 8-hydroxychromen-2-one. InChIKey: DPTUTXWBBUARQB-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 8-hydroxychromen-2-one |
| InChIKey | DPTUTXWBBUARQB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC(=O)C=C2 |
Computed by PubChem (NCBI)