cas: 2442-31-1 — see every product listed under this CAS number, including other names
8-Hydroxycoumarin, 99.95% (CAS 2442-31-1) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-21509-10mM/1mL |
| cas | 2442-31-1 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 491.52 Pln | |
| MedChemExpress | 100 mg | 454.37 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.95% |
8-hydroxychromen-2-one (CAS 2442-31-1) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 8-hydroxychromen-2-one. InChIKey: DPTUTXWBBUARQB-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 8-hydroxychromen-2-one |
| InChIKey | DPTUTXWBBUARQB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC(=O)C=C2 |
Computed by PubChem (NCBI)