cas: 34954-65-9 — see every product listed under this CAS number, including other names
8-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione 98% (CAS 34954-65-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A805527-250mg |
| cas | 34954-65-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1338.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A805527 |
8-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 34954-65-9) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 8-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: ZPTOZGCACQWXJX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 8-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | ZPTOZGCACQWXJX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1NC(=O)OC2=O |
Computed by PubChem (NCBI)