cas: 34954-65-9 — see every product listed under this CAS number, including other names
3-Methoxy-isatoic anhydride, 98% (CAS 34954-65-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040465-1G |
| cas | 34954-65-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 2.5g | 966.34 Pln | |
| Fluorochem | 5g | 1315.18 Pln | |
| Fluorochem | 25g | 5704.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
8-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 34954-65-9) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 8-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: ZPTOZGCACQWXJX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 8-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | ZPTOZGCACQWXJX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1NC(=O)OC2=O |
Computed by PubChem (NCBI)