cas: 73868-15-2 — see every product listed under this CAS number, including other names
8-Nitroquinolin-3-amine, 95%, 95% (CAS 73868-15-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FHFI-100mg |
| cas | 73868-15-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 500mg | 1629.20 Pln | |
| Chemat | 1g | 1778.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-nitroquinolin-3-amine (CAS 73868-15-2) is a chemical compound with the molecular formula C9H7N3O2 and a molecular weight of 189.17 g/mol. IUPAC name: 8-nitroquinolin-3-amine. InChIKey: FSRWHNLTQBQFHI-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 8-nitroquinolin-3-amine |
| InChIKey | FSRWHNLTQBQFHI-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)