8-Oxo-5,6,7,8-tetrahydroquinoline-2-carboxylic acid, 95%
cas: 238755-39-0 — see every product listed under this CAS number, including other names
8-Oxo-5,6,7,8-tetrahydroquinoline-2-carboxylic acid, 95% (CAS 238755-39-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A640622-250mg |
| cas | 238755-39-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1026.75 Pln | |
| Ambeed | 1g | 2651.00 Pln | |
| Ambeed | 5g | 9109.06 Pln | |
| Chemat | 250mg | 1024.40 Pln | |
| Chemat | 1g | 2661.20 Pln | |
| Chemat | 5g | 9155.60 Pln | |
| BLDpharm | 250mg | 1102.97 Pln | |
| BLDpharm | 1g | 2852.35 Pln | |
| BLDpharm | 5g | 9816.57 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
8-oxo-6,7-dihydro-5H-quinoline-2-carboxylic acid (CAS 238755-39-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 8-oxo-6,7-dihydro-5H-quinoline-2-carboxylic acid. InChIKey: WELUSJMDROQOAE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 8-oxo-6,7-dihydro-5H-quinoline-2-carboxylic acid |
| InChIKey | WELUSJMDROQOAE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)N=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)