9-Oxo-9H-xanthene-2-carboxylic acid, 98%
cas: 40274-67-7 — see every product listed under this CAS number, including other names
9-Oxo-9H-xanthene-2-carboxylic acid, 98% (CAS 40274-67-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A172008-250mg |
| cas | 40274-67-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 976.69 Pln | |
| Ambeed | 1g | 2322.81 Pln | |
| Ambeed | 5g | 6839.56 Pln | |
| Chemat | 50mg | 270.80 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 1701.20 Pln | |
| Chemat | 5g | 6875.60 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 1047.43 Pln | |
| BLDpharm | 1g | 2502.48 Pln | |
| BLDpharm | 5g | 7367.43 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
9-oxoxanthene-2-carboxylic acid (CAS 40274-67-7) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 9-oxoxanthene-2-carboxylic acid. InChIKey: JNPRWSKMJDGYAN-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 9-oxoxanthene-2-carboxylic acid |
| InChIKey | JNPRWSKMJDGYAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)
