cas: 525-64-4 — see every product listed under this CAS number, including other names
9H-Fluorene-2,7-diamine (CAS 525-64-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236714-100MG |
| cas | 525-64-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1934.75 Pln | |
| Fluorochem | 25g | 7651.49 Pln |
| delivery time | 3-4 weeks |
|---|
9H-fluorene-2,7-diamine (CAS 525-64-4) is a chemical compound with the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. IUPAC name: 9H-fluorene-2,7-diamine. InChIKey: SNCJAJRILVFXAE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 9H-fluorene-2,7-diamine |
| InChIKey | SNCJAJRILVFXAE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)C3=C1C=C(C=C3)N |
Computed by PubChem (NCBI)