Products 393121-74-9
CAS 393121-74-9 appears in our catalog under these names: AA147/ 99.79% (existing batch purity), AA 147, AA 147, AA147 99%, N-(2-Hydroxy-5-methylphenyl)-3-phenylpropanamide, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg, 10mM (in 1ml dmso).
N-(2-hydroxy-5-methylphenyl)-3-phenylpropanamide (CAS 393121-74-9) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: N-(2-hydroxy-5-methylphenyl)-3-phenylpropanamide. InChIKey: AWHLTHOHBAGPMY-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | N-(2-hydroxy-5-methylphenyl)-3-phenylpropanamide |
| InChIKey | AWHLTHOHBAGPMY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)NC(=O)CCC2=CC=CC=C2 |
Computed by PubChem (NCBI)