Products 34232-27-4
CAS 34232-27-4 appears in our catalog under these names: Acetylalkannin, Acetylalkannin/ 99.64% (existing batch purity), Acetylalkannin 98%, (S)-1-(5,8-Dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl acetate, 95%, 95%, Acetylalkannin, 99.85%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 10 mg, 5 mg, 25 mg.
[(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] acetate (CAS 34232-27-4) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: [(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] acetate. InChIKey: WNFXUXZJJKTDOZ-HNNXBMFYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [(1S)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] acetate |
| InChIKey | WNFXUXZJJKTDOZ-HNNXBMFYSA-N |
| SMILES | CC(=CC[C@@H](C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)OC(=O)C)C |
Computed by PubChem (NCBI)