cas: 332927-03-4 — see every product listed under this CAS number, including other names
Acridine-9-carboxylic acid xhydrate 97% (CAS 332927-03-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1152612-1g |
| cas | 332927-03-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 515.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1152612 |
Acridine-9-carboxylic acid;hydrate (CAS 332927-03-4) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: acridine-9-carboxylic acid;hydrate. InChIKey: ZQAZWHSZYVXGMP-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | acridine-9-carboxylic acid;hydrate |
| InChIKey | ZQAZWHSZYVXGMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)C(=O)O.O |
Computed by PubChem (NCBI)