Allyl 4-aminobenzoate hydrochloride, 95%
cas: 1087731-00-7 — see every product listed under this CAS number, including other names
Allyl 4-aminobenzoate hydrochloride, 95% (CAS 1087731-00-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1728730-1g |
| cas | 1087731-00-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 542.81 Pln | |
| Ambeed | 25g | 1710.94 Pln | |
| Ambeed | 100g | 5332.12 Pln | |
| BLDpharm | 1g | 203.29 Pln | |
| BLDpharm | 5g | 530.95 Pln | |
| BLDpharm | 25g | 1686.10 Pln | |
| BLDpharm | 100g | 5229.29 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 482.00 Pln | |
| Chemat | 25g | 1518.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Prop-2-enyl 4-aminobenzoate;hydrochloride (CAS 1087731-00-7) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: prop-2-enyl 4-aminobenzoate;hydrochloride. InChIKey: XNYJATWQNHGTGW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | prop-2-enyl 4-aminobenzoate;hydrochloride |
| InChIKey | XNYJATWQNHGTGW-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Allyl 4-aminobenzoate hydrochloride