CAS 596-38-3 appears in our catalog under these names: 9–Phenylxanthen–9–ol, 9-Phenylxanthen-9-ol, 9-Phenyl-9H-xanthen-9-ol, 98%, 98%, Antioxidant agent-15, 98.97%, 9-Phenyl-9H-xanthen-9-ol, 98%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 250mg, 100 mg.
9-phenylxanthen-9-ol (CAS 596-38-3) is a chemical compound with the molecular formula C19H14O2 and a molecular weight of 274.3 g/mol. IUPAC name: 9-phenylxanthen-9-ol. InChIKey: CVZUPKFPOSRRSK-UHFFFAOYSA-N.
| Molecular formula | C19H14O2 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 9-phenylxanthen-9-ol |
| InChIKey | CVZUPKFPOSRRSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3OC4=CC=CC=C42)O |
Computed by PubChem (NCBI)