Products 1607803-67-7

CAS 1607803-67-7 appears in our catalog under these names: B I09/ 99.23% (existing batch purity), B I09, B I09, 99.35%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 0,025g, 5 mg.

Structural formula: {0} (CAS {1})

7-(1,3-dioxan-2-yl)-8-hydroxy-1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one (CAS 1607803-67-7) is a chemical compound with the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. IUPAC name: 7-(1,3-dioxan-2-yl)-8-hydroxy-1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one. InChIKey: UYYMWNUDIOPESF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO5
Molecular weight303.31 g/mol
IUPAC name7-(1,3-dioxan-2-yl)-8-hydroxy-1,2,3,4-tetrahydrochromeno[3,4-c]pyridin-5-one
InChIKeyUYYMWNUDIOPESF-UHFFFAOYSA-N
SMILESC1COC(OC1)C2=C(C=CC3=C2OC(=O)C4=C3CCNC4)O

Computed by PubChem (NCBI)