2,9-Dimethyl-4,7-diphenyl-1,10-phenanthroline, 99% (CAS 4733-39-5) manufactured by Lumtec in a 1g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-E304-1g |
| cas | 4733-39-5 |
| size | 1g |
| availability | 12.11.2021: In Stock |
Ask us about this product — we're happy to help.
| purity | 99% |
|---|
2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline (CAS 4733-39-5) is a chemical compound with the molecular formula C26H20N2 and a molecular weight of 360.4 g/mol. IUPAC name: 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline. InChIKey: STTGYIUESPWXOW-UHFFFAOYSA-N.
| Molecular formula | C26H20N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| InChIKey | STTGYIUESPWXOW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC3=C(C=C(N=C3C2=N1)C)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)