CAS 134476-36-1 appears in our catalog under these names: 1-Ethylphenoxathiin 10,10-dioxide, BW-1370U87/ 99.89% (existing batch purity), BW1370U87. Offered by: Chemat, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
1-ethylphenoxathiine 10,10-dioxide (CAS 134476-36-1) is a chemical compound with the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. IUPAC name: 1-ethylphenoxathiine 10,10-dioxide. InChIKey: HQSRQKBSOOZLHH-UHFFFAOYSA-N.
| Molecular formula | C14H12O3S |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 1-ethylphenoxathiine 10,10-dioxide |
| InChIKey | HQSRQKBSOOZLHH-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)OC3=CC=CC=C3S2(=O)=O |
Computed by PubChem (NCBI)