cas: 1879026-17-1 — see every product listed under this CAS number, including other names
Benzaldehyde, 6-bromo-2,4-difluoro-3-methyl-, 95%, 95% (CAS 1879026-17-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12RUBA-1g |
| cas | 1879026-17-1 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 630.80 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 462.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2,4-difluoro-3-methylbenzaldehyde (CAS 1879026-17-1) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 6-bromo-2,4-difluoro-3-methylbenzaldehyde. InChIKey: FCZTVKMRAPETSG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 6-bromo-2,4-difluoro-3-methylbenzaldehyde |
| InChIKey | FCZTVKMRAPETSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1F)Br)C=O)F |
Computed by PubChem (NCBI)