cas: 3393-77-9 — see every product listed under this CAS number, including other names
Benzene, 1,1'-thiobis[4-methoxy-, 98% (CAS 3393-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F980585-100MG |
| cas | 3393-77-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 450.90 Pln | |
| Fluorochem | 250mg | 716.43 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-methoxy-4-(4-methoxyphenyl)sulfanylbenzene (CAS 3393-77-9) is a chemical compound with the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. IUPAC name: 1-methoxy-4-(4-methoxyphenyl)sulfanylbenzene. InChIKey: UKHKZGJCPDWXQY-UHFFFAOYSA-N.
| Molecular formula | C14H14O2S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 1-methoxy-4-(4-methoxyphenyl)sulfanylbenzene |
| InChIKey | UKHKZGJCPDWXQY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)SC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)