CAS 1678-25-7 appears in our catalog under these names: Benzenesulfonanilide, Benzenesulfonanilide, >98.0%(HPLC)(N), Benzenesulfonanilide, 97%, 97%, N-Phenylbenzenesulfonamide, 98%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 0,25g, 2,5g, 1g, 5g, 10g.
N-phenylbenzenesulfonamide (CAS 1678-25-7) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: N-phenylbenzenesulfonamide. InChIKey: XAUGWFWQVYXATQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | N-phenylbenzenesulfonamide |
| InChIKey | XAUGWFWQVYXATQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)