CAS 847744-15-4 appears in our catalog under these names: 2-(4-Ethylphenyl)thiazole-4-carboxylic acid, 97%, 2-(4-Ethylphenyl)-1,3-thiazole-4-carboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
2-(4-ethylphenyl)-1,3-thiazole-4-carboxylic acid (CAS 847744-15-4) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: OKIXVEUDAQRHLQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | OKIXVEUDAQRHLQ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)