Products 850375-07-4
CAS 850375-07-4 appears in our catalog under these names: 3-(2-Methyl-thiazol-4-yl)-benzoic acid methyl ester, 98%, 3-(2-Methyl-thiazol-4-yl)-benzoic acid methyl ester, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 250mg, 1g.
Methyl 3-(2-methyl-1,3-thiazol-4-yl)benzoate (CAS 850375-07-4) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: methyl 3-(2-methyl-1,3-thiazol-4-yl)benzoate. InChIKey: MLILPQRJIOVKFH-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | methyl 3-(2-methyl-1,3-thiazol-4-yl)benzoate |
| InChIKey | MLILPQRJIOVKFH-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)