CAS 876715-98-9 is the registry number for 2-Benzyl-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
2-benzyl-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 876715-98-9) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 2-benzyl-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: SGWCGSNQYPEXBO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-benzyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | SGWCGSNQYPEXBO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)