Products 858486-04-1
CAS 858486-04-1 appears in our catalog under these names: (2-Benzyl-1,3-thiazol-4-yl)acetic acid, 95%, (2-Benzyl-1,3-thiazol-4-yl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-(2-benzyl-1,3-thiazol-4-yl)acetic acid (CAS 858486-04-1) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 2-(2-benzyl-1,3-thiazol-4-yl)acetic acid. InChIKey: UJRCHAXRBQIJNK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-(2-benzyl-1,3-thiazol-4-yl)acetic acid |
| InChIKey | UJRCHAXRBQIJNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)