CAS 26176-22-7 appears in our catalog under these names: 2-(1H-Pyrrol-1-yl)-5,6-dihydro-4h-cyclopenta[b]thiophene-3-carboxylic acid, 95%, 2-(1H-Pyrrol-1-yl)-4H,5H,6H-cyclopenta(b)thiophene-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g.
2-pyrrol-1-yl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid (CAS 26176-22-7) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 2-pyrrol-1-yl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid. InChIKey: AFUGGWFQZJEYCV-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-pyrrol-1-yl-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylic acid |
| InChIKey | AFUGGWFQZJEYCV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2C(=O)O)N3C=CC=C3 |
Computed by PubChem (NCBI)