CAS 101736-22-5 appears in our catalog under these names: 2-(5-Methyl-2-phenylthiazole-4-yl)acetic acid, 95%, 2-(5-Methyl-2-phenylthiazol-4-yl)acetic acid, 95+%, (5-Methyl-2-phenylthiazole-4-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetic acid (CAS 101736-22-5) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetic acid. InChIKey: SZYXURFSAUXFNT-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 2-(5-methyl-2-phenyl-1,3-thiazol-4-yl)acetic acid |
| InChIKey | SZYXURFSAUXFNT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=CC=CC=C2)CC(=O)O |
Computed by PubChem (NCBI)