cas: 50917-28-7 — see every product listed under this CAS number, including other names
Benzoic acid, 3-amino-2,4-dichloro- (7CI,9CI), 98% (CAS 50917-28-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863604-100MG |
| cas | 50917-28-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 4074.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-amino-2,4-dichlorobenzoic acid (CAS 50917-28-7) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 3-amino-2,4-dichlorobenzoic acid. InChIKey: MWIWETSWQFRAPN-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 3-amino-2,4-dichlorobenzoic acid |
| InChIKey | MWIWETSWQFRAPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)N)Cl |
Computed by PubChem (NCBI)