cas: 1093418-75-7 — see every product listed under this CAS number, including other names
Benzoic acid, 4-bromo-2-iodo-, methyl ester, 97%, 97% (CAS 1093418-75-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104LM-1g |
| cas | 1093418-75-7 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 100g | 870.80 Pln | |
| Chemat | 500g | 3110.40 Pln | |
| Chemat | 50g | 549.20 Pln | |
| Chemat | 250g | 1614.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-2-iodobenzoate (CAS 1093418-75-7) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: methyl 4-bromo-2-iodobenzoate. InChIKey: VAYKANWZAJRNOM-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | methyl 4-bromo-2-iodobenzoate |
| InChIKey | VAYKANWZAJRNOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)I |
Computed by PubChem (NCBI)