Products 496944-09-3
CAS 496944-09-3 appears in our catalog under these names: 4-(Bromomethyl)-3-iodobenzoic acid, 4-(Bromomethyl)-3-iodobenzoic acid, 95%, 4-(Bromomethyl)-3-iodobenzoic acid, 97%. Offered by: Chemat, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 25g.
4-(bromomethyl)-3-iodobenzoic acid (CAS 496944-09-3) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 4-(bromomethyl)-3-iodobenzoic acid. InChIKey: NKFSSHMERMOVGK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | 4-(bromomethyl)-3-iodobenzoic acid |
| InChIKey | NKFSSHMERMOVGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)I)CBr |
Computed by PubChem (NCBI)