Products 2091451-28-2

CAS 2091451-28-2 is the registry number for 5-Bromo-2-iodo-4-methyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-bromo-2-iodo-4-methylbenzoic acid (CAS 2091451-28-2) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 5-bromo-2-iodo-4-methylbenzoic acid. InChIKey: BIFFHWPQUXSIBR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrIO2
Molecular weight340.94 g/mol
IUPAC name5-bromo-2-iodo-4-methylbenzoic acid
InChIKeyBIFFHWPQUXSIBR-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1Br)C(=O)O)I

Computed by PubChem (NCBI)