Products 1093418-75-7
CAS 1093418-75-7 appears in our catalog under these names: Methyl 4-bromo-2-iodobenzoate, 98%, methyl 4-bromo-2-iodobenzoate, Methyl 4-bromo-2-iodobenzoate 99%, Benzoic acid, 4-bromo-2-iodo-, methyl ester, 97%, 97%, METHYL 4-BROMO-2-IODO-BENZOATE, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 100g, 500g, 50g, 250g.
Methyl 4-bromo-2-iodobenzoate (CAS 1093418-75-7) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: methyl 4-bromo-2-iodobenzoate. InChIKey: VAYKANWZAJRNOM-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | methyl 4-bromo-2-iodobenzoate |
| InChIKey | VAYKANWZAJRNOM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)I |
Computed by PubChem (NCBI)