Products 153254-99-0
CAS 153254-99-0 is the registry number for 5-(Bromomethyl)-6-iodo-1,3-benzodioxole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-(bromomethyl)-6-iodo-1,3-benzodioxole (CAS 153254-99-0) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 5-(bromomethyl)-6-iodo-1,3-benzodioxole. InChIKey: VRDLFDFGPIQUDK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | 5-(bromomethyl)-6-iodo-1,3-benzodioxole |
| InChIKey | VRDLFDFGPIQUDK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CBr)I |
Computed by PubChem (NCBI)