Products 1022983-50-1
CAS 1022983-50-1 appears in our catalog under these names: 3-Bromo-5-iodo-2-methyl benzoic acid, 95%, 3-Bromo-5-iodo-2-methylbenzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
3-bromo-5-iodo-2-methylbenzoic acid (CAS 1022983-50-1) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 3-bromo-5-iodo-2-methylbenzoic acid. InChIKey: JGSFWZGJNRDWDV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | 3-bromo-5-iodo-2-methylbenzoic acid |
| InChIKey | JGSFWZGJNRDWDV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)I)C(=O)O |
Computed by PubChem (NCBI)