Products 2092356-54-0

CAS 2092356-54-0 appears in our catalog under these names: 3-Bromo-4-iodo-5-methylbenzoic acid, 95%, 3-Bromo-4-iodo-5-methylbenzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-bromo-4-iodo-5-methylbenzoic acid (CAS 2092356-54-0) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: 3-bromo-4-iodo-5-methylbenzoic acid. InChIKey: TUSANVARIZHLPS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrIO2
Molecular weight340.94 g/mol
IUPAC name3-bromo-4-iodo-5-methylbenzoic acid
InChIKeyTUSANVARIZHLPS-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1I)Br)C(=O)O

Computed by PubChem (NCBI)