cas: 77513-40-7 — see every product listed under this CAS number, including other names
Benzyl 3-Hydroxybenzoate, 98%, 98% (CAS 77513-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116T96-100mg |
| cas | 77513-40-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 429.20 Pln | |
| Chemat | 5g | 1590.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-hydroxybenzoate (CAS 77513-40-7) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: benzyl 3-hydroxybenzoate. InChIKey: QCLMZTCDRVMSHA-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | benzyl 3-hydroxybenzoate |
| InChIKey | QCLMZTCDRVMSHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)