Benzyl 3-aminopropanoate hydrochloride, 96%
cas: 99616-43-0 — see every product listed under this CAS number, including other names
Benzyl 3-aminopropanoate hydrochloride, 96% (CAS 99616-43-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 100g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A740133-1g |
| cas | 99616-43-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1082.38 Pln | |
| BLDpharm | 1g | 164.41 Pln | |
| BLDpharm | 5g | 386.56 Pln | |
| BLDpharm | 25g | 1158.51 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 822.80 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 25g | 1075.68 Pln | |
| Fluorochem | 100g | 3366.54 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl 3-aminopropanoate;hydrochloride (CAS 99616-43-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl 3-aminopropanoate;hydrochloride. InChIKey: QIBWNGWEFYSLCM-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl 3-aminopropanoate;hydrochloride |
| InChIKey | QIBWNGWEFYSLCM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCN.Cl |
Computed by PubChem (NCBI)