Products 5557-81-3
CAS 5557-81-3 appears in our catalog under these names: Benzyl 2-aminopropanoate hydrochloride, 95%, H-DL-Ala-Obzl.HCl, 97%, L–alanine benzyl ester hydrochloride, Benzyl 2-aopropanoate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 1g, 5g, 200mg.
Benzyl 2-aminopropanoate;hydrochloride (CAS 5557-81-3) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl 2-aminopropanoate;hydrochloride. InChIKey: RLMHWGDKMJIEHH-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl 2-aminopropanoate;hydrochloride |
| InChIKey | RLMHWGDKMJIEHH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)