cas: 6962-04-5 — see every product listed under this CAS number, including other names
Bis(4-chlorophenyl)amine 98% (CAS 6962-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192041-100g |
| cas | 6962-04-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 6672.69 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 481.62 Pln | |
| Ambeed | 25g | 2133.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A192041 |
4-chloro-N-(4-chlorophenyl)aniline (CAS 6962-04-5) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 4-chloro-N-(4-chlorophenyl)aniline. InChIKey: PTHWAPQEXRZRJW-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4-chloro-N-(4-chlorophenyl)aniline |
| InChIKey | PTHWAPQEXRZRJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)