cas: 6962-04-5 — see every product listed under this CAS number, including other names
Bis(4-chlorophenyl)amine, 98%, 98% (CAS 6962-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 100g, 250g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FKP5-100mg |
| cas | 6962-04-5 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 100g | 4485.20 Pln | |
| Chemat | 250g | 8176.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 25g | 1235.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-N-(4-chlorophenyl)aniline (CAS 6962-04-5) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 4-chloro-N-(4-chlorophenyl)aniline. InChIKey: PTHWAPQEXRZRJW-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4-chloro-N-(4-chlorophenyl)aniline |
| InChIKey | PTHWAPQEXRZRJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)