Bis(4-chlorophenyl)amine, 98%
cas: 6962-04-5 — see every product listed under this CAS number, including other names
Bis(4-chlorophenyl)amine, 98% (CAS 6962-04-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g, 100g, 100mg, 250mg, 10g, 250g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | HG-4164-5g |
| cas | 6962-04-5 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1761.00 Pln | |
| Ambeed | 100g | 5148.56 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1182.80 Pln | |
| Chemat | 100g | 4485.20 Pln | |
| Chemat | 250g | 8176.40 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 519.84 Pln | |
| BLDpharm | 25g | 1897.13 Pln | |
| BLDpharm | 100g | 5545.85 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-chloro-N-(4-chlorophenyl)aniline (CAS 6962-04-5) is a chemical compound with the molecular formula C12H9Cl2N and a molecular weight of 238.11 g/mol. IUPAC name: 4-chloro-N-(4-chlorophenyl)aniline. InChIKey: PTHWAPQEXRZRJW-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2N |
|---|---|
| Molecular weight | 238.11 g/mol |
| IUPAC name | 4-chloro-N-(4-chlorophenyl)aniline |
| InChIKey | PTHWAPQEXRZRJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)