cas: 66493-39-8 — see every product listed under this CAS number, including other names
Boc-4-Abz-OH 98% (CAS 66493-39-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A136088-1g |
| cas | 66493-39-8 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 370.38 Pln | |
| Ambeed | 500g | 1555.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A136088 |
4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 66493-39-8) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: ZJDBQMWMDZEONW-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | ZJDBQMWMDZEONW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)