Products 91738-83-9

CAS 91738-83-9 is the registry number for Z-N-Me-dl-ala-oh dcha, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 100g, 5g.

Structural formula: {0} (CAS {1})

2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid (CAS 91738-83-9) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid. InChIKey: QGEQKVZQPWSOTI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO4
Molecular weight237.25 g/mol
IUPAC name2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid
InChIKeyQGEQKVZQPWSOTI-UHFFFAOYSA-N
SMILESCC(C(=O)O)N(C)C(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)