Products 28047-05-4
CAS 28047-05-4 appears in our catalog under these names: Ac-tyr(me)-oh, 98%, Acetyl–O–methyl–L–tyrosine, (S)-2-Acetamido-3-(4-methoxyphenyl)propanoic acid, 98%, 98%, Acetyl-O-methyl-L-tyrosine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg.
(2S)-2-acetamido-3-(4-methoxyphenyl)propanoic acid (CAS 28047-05-4) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-acetamido-3-(4-methoxyphenyl)propanoic acid. InChIKey: HRUASHPCEMXOMR-NSHDSACASA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | HRUASHPCEMXOMR-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)